C22H33N3O2 — CID 23790905
N-[(3-acetamidophenyl)methyl]-N-(2-aminocyclohexyl)cyclohexanecarboxamide (PubChem CID 23790905) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[(3-acetamidophenyl)methyl]-N-(2-aminocyclohexyl)cyclohexanecarboxamide.
| Compound Name | N-[(3-acetamidophenyl)methyl]-N-(2-aminocyclohexyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 23790905 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[(3-acetamidophenyl)methyl]-N-(2-aminocyclohexyl)cyclohexanecarboxamide |
| SMILES | CC(=O)Nc1cccc(CN(C(=O)C2CCCCC2)C2CCCCC2N)c1 |
| InChI | InChI=1S/C22H33N3O2/c1-16(26)24-19-11-7-8-17(14-19)15-25(21-13-6-5-12-20(21)23)22(27)18-9-3-2-4-10-18/h7-8,11,14,18,20-21H,2-6,9-10,12-13,15,23H2,1H3,(H,24,26) |
| InChIKey | INJRPLVYJJMMSW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |