C21H30ClN3O2 — CID 23908761
N-[3-[[acetyl-(2-aminocyclohexyl)amino]methyl]-4-chlorophenyl]cyclopentanecarboxamide (PubChem CID 23908761) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-[3-[[acetyl-(2-aminocyclohexyl)amino]methyl]-4-chlorophenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[acetyl-(2-aminocyclohexyl)amino]methyl]-4-chlorophenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 23908761 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[3-[[acetyl-(2-aminocyclohexyl)amino]methyl]-4-chlorophenyl]cyclopentanecarboxamide |
| SMILES | CC(=O)N(Cc1cc(NC(=O)C2CCCC2)ccc1Cl)C1CCCCC1N |
| InChI | InChI=1S/C21H30ClN3O2/c1-14(26)25(20-9-5-4-8-19(20)23)13-16-12-17(10-11-18(16)22)24-21(27)15-6-2-3-7-15/h10-12,15,19-20H,2-9,13,23H2,1H3,(H,24,27) |
| InChIKey | FXCKQPZUBKUFJU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |