C27H34ClN3O2 — CID 46138113
2-chloro-N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-cyclohexylbenzamide (PubChem CID 46138113) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 2-chloro-N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-cyclohexylbenzamide.
| Compound Name | 2-chloro-N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 46138113 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-chloro-N-[[5-(cyclobutanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-cyclohexylbenzamide |
| SMILES | CN(C)c1ccc(NC(=O)C2CCC2)cc1CN(C(=O)c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-30(2)25-16-15-21(29-26(32)19-9-8-10-19)17-20(25)18-31(22-11-4-3-5-12-22)27(33)23-13-6-7-14-24(23)28/h6-7,13-17,19,22H,3-5,8-12,18H2,1-2H3,(H,29,32) |
| InChIKey | ZSXYLILKQNKMNL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|