C30H34ClN3O2 — CID 93128322
2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 93128322) has the molecular formula C30H34ClN3O2 and a molecular weight of 504.07 g/mol. Its IUPAC name is 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93128322 |
| Molecular Formula | C30H34ClN3O2 |
| Molecular Weight | 504.07 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-chloro-N-[[5-(cyclopentanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@H](c1ccccc1)N(Cc1cc(NC(=O)C2CCCC2)ccc1N(C)C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C30H34ClN3O2/c1-21(22-11-5-4-6-12-22)34(30(36)26-15-9-10-16-27(26)31)20-24-19-25(17-18-28(24)33(2)3)32-29(35)23-13-7-8-14-23/h4-6,9-12,15-19,21,23H,7-8,13-14,20H2,1-3H3,(H,32,35)/t21-/m1/s1 |
| InChIKey | AACRWKAQOLHORG-OAQYLSRUSA-N |
| XLogP | 6.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.07 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|