C25H32ClN3O2 — CID 93128597
2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide (PubChem CID 93128597) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 93128597 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(2S)-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@H](C)N(Cc1cc(NC(=O)C2CC2)ccc1N(C)C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H32ClN3O2/c1-16(2)17(3)29(25(31)21-8-6-7-9-22(21)26)15-19-14-20(12-13-23(19)28(4)5)27-24(30)18-10-11-18/h6-9,12-14,16-18H,10-11,15H2,1-5H3,(H,27,30)/t17-/m0/s1 |
| InChIKey | ZBRFKQKHNSGXQP-KRWDZBQOSA-N |
| XLogP | 5.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|