C28H30ClN3O2 — CID 93128317
2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 93128317) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93128317 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-chloro-N-[[5-(cyclopropanecarbonylamino)-2-(dimethylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](c1ccccc1)N(Cc1cc(NC(=O)C2CC2)ccc1N(C)C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C28H30ClN3O2/c1-19(20-9-5-4-6-10-20)32(28(34)24-11-7-8-12-25(24)29)18-22-17-23(15-16-26(22)31(2)3)30-27(33)21-13-14-21/h4-12,15-17,19,21H,13-14,18H2,1-3H3,(H,30,33)/t19-/m0/s1 |
| InChIKey | YTYFVYVQDSPLNY-IBGZPJMESA-N |
| XLogP | 6.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|