C27H32ClN3O3S — CID 93128364
2-chloro-N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 93128364) has the molecular formula C27H32ClN3O3S and a molecular weight of 514.09 g/mol. Its IUPAC name is 2-chloro-N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-chloro-N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93128364 |
| Molecular Formula | C27H32ClN3O3S |
| Molecular Weight | 514.09 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 2-chloro-N-[[2-(dimethylamino)-5-(propylsulfonylamino)phenyl]methyl]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2ccccc2Cl)[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C27H32ClN3O3S/c1-5-17-35(33,34)29-23-15-16-26(30(3)4)22(18-23)19-31(20(2)21-11-7-6-8-12-21)27(32)24-13-9-10-14-25(24)28/h6-16,18,20,29H,5,17,19H2,1-4H3/t20-/m0/s1 |
| InChIKey | YDIHAAVFDLJWOO-FQEVSTJZSA-N |
| XLogP | 5.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.09 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|