C28H33N3O3 — CID 93128295
N-[[2-(dimethylamino)-5-(propanoylamino)phenyl]methyl]-4-methoxy-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 93128295) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-5-(propanoylamino)phenyl]methyl]-4-methoxy-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | N-[[2-(dimethylamino)-5-(propanoylamino)phenyl]methyl]-4-methoxy-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93128295 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | N-[[2-(dimethylamino)-5-(propanoylamino)phenyl]methyl]-4-methoxy-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | CCC(=O)Nc1ccc(N(C)C)c(CN(C(=O)c2ccc(OC)cc2)[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C28H33N3O3/c1-6-27(32)29-24-14-17-26(30(3)4)23(18-24)19-31(20(2)21-10-8-7-9-11-21)28(33)22-12-15-25(34-5)16-13-22/h7-18,20H,6,19H2,1-5H3,(H,29,32)/t20-/m0/s1 |
| InChIKey | ZDQXGYPYFYKHOC-FQEVSTJZSA-N |
| XLogP | 5.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|