C26H31N3O2S — CID 42817485
N-[4-(dimethylamino)-3-[[1-phenylethyl-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]propanamide (PubChem CID 42817485) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[1-phenylethyl-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]propanamide.
| Compound Name | N-[4-(dimethylamino)-3-[[1-phenylethyl-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 42817485 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[1-phenylethyl-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(N(C)C)c(CN(C(=O)Cc2cccs2)C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C26H31N3O2S/c1-5-25(30)27-22-13-14-24(28(3)4)21(16-22)18-29(19(2)20-10-7-6-8-11-20)26(31)17-23-12-9-15-32-23/h6-16,19H,5,17-18H2,1-4H3,(H,27,30) |
| InChIKey | IMAKFWRWQBGHRO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|