C25H34ClN3O2 — CID 93019446
N-[[5-[[(2R)-2-chloropropanoyl]amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-[(1R)-1-phenylethyl]propanamide (PubChem CID 93019446) has the molecular formula C25H34ClN3O2 and a molecular weight of 444.02 g/mol. Its IUPAC name is N-[[5-[[(2R)-2-chloropropanoyl]amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-[(1R)-1-phenylethyl]propanamide.
| Compound Name | N-[[5-[[(2R)-2-chloropropanoyl]amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-[(1R)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 93019446 |
| Molecular Formula | C25H34ClN3O2 |
| Molecular Weight | 444.02 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | N-[[5-[[(2R)-2-chloropropanoyl]amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-[(1R)-1-phenylethyl]propanamide |
| SMILES | C[C@H](c1ccccc1)N(Cc1cc(NC(=O)[C@@H](C)Cl)ccc1N(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C25H34ClN3O2/c1-17(26)23(30)27-21-13-14-22(28(6)7)20(15-21)16-29(24(31)25(3,4)5)18(2)19-11-9-8-10-12-19/h8-15,17-18H,16H2,1-7H3,(H,27,30)/t17-,18-/m1/s1 |
| InChIKey | MHMVYKZIIGTCSC-QZTJIDSGSA-N |
| XLogP | 5.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|