C27H34N4O3 — CID 42817506
N-[3-[[tert-butylcarbamoyl(1-phenylethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide (PubChem CID 42817506) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[3-[[tert-butylcarbamoyl(1-phenylethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[tert-butylcarbamoyl(1-phenylethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42817506 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N-[3-[[tert-butylcarbamoyl(1-phenylethyl)amino]methyl]-4-(dimethylamino)phenyl]furan-2-carboxamide |
| SMILES | CC(c1ccccc1)N(Cc1cc(NC(=O)c2ccco2)ccc1N(C)C)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C27H34N4O3/c1-19(20-11-8-7-9-12-20)31(26(33)29-27(2,3)4)18-21-17-22(14-15-23(21)30(5)6)28-25(32)24-13-10-16-34-24/h7-17,19H,18H2,1-6H3,(H,28,32)(H,29,33) |
| InChIKey | OIGZSIAQRPPXGZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|