C27H38ClN3O2 — CID 93019428
3-chloro-N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[(1R)-1-phenylethyl]amino]methyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 93019428) has the molecular formula C27H38ClN3O2 and a molecular weight of 472.07 g/mol. Its IUPAC name is 3-chloro-N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[(1R)-1-phenylethyl]amino]methyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[(1R)-1-phenylethyl]amino]methyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 93019428 |
| Molecular Formula | C27H38ClN3O2 |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 3-chloro-N-[4-(dimethylamino)-3-[[2,2-dimethylpropanoyl-[(1R)-1-phenylethyl]amino]methyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | C[C@H](c1ccccc1)N(Cc1cc(NC(=O)C(C)(C)CCl)ccc1N(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C27H38ClN3O2/c1-19(20-12-10-9-11-13-20)31(25(33)26(2,3)4)17-21-16-22(14-15-23(21)30(7)8)29-24(32)27(5,6)18-28/h9-16,19H,17-18H2,1-8H3,(H,29,32)/t19-/m1/s1 |
| InChIKey | CIGARKDVKMOGLD-LJQANCHMSA-N |
| XLogP | 6.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|