C24H32ClN3O2 — CID 46111076
N-[[5-[(2-chloroacetyl)amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-(1-phenylethyl)propanamide (PubChem CID 46111076) has the molecular formula C24H32ClN3O2 and a molecular weight of 429.99 g/mol. Its IUPAC name is N-[[5-[(2-chloroacetyl)amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-(1-phenylethyl)propanamide.
| Compound Name | N-[[5-[(2-chloroacetyl)amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-(1-phenylethyl)propanamide |
|---|---|
| PubChem CID | 46111076 |
| Molecular Formula | C24H32ClN3O2 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[[5-[(2-chloroacetyl)amino]-2-(dimethylamino)phenyl]methyl]-2,2-dimethyl-N-(1-phenylethyl)propanamide |
| SMILES | CC(c1ccccc1)N(Cc1cc(NC(=O)CCl)ccc1N(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H32ClN3O2/c1-17(18-10-8-7-9-11-18)28(23(30)24(2,3)4)16-19-14-20(26-22(29)15-25)12-13-21(19)27(5)6/h7-14,17H,15-16H2,1-6H3,(H,26,29) |
| InChIKey | KCLIGHHNUFQFJI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|