C20H25NO — CID 126749944
N-benzyl-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide (PubChem CID 126749944) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide.
| Compound Name | N-benzyl-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide |
|---|---|
| PubChem CID | 126749944 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-benzyl-2,2-dimethyl-N-[(1S)-1-phenylethyl]propanamide |
| SMILES | C[C@@H](c1ccccc1)N(Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C20H25NO/c1-16(18-13-9-6-10-14-18)21(19(22)20(2,3)4)15-17-11-7-5-8-12-17/h5-14,16H,15H2,1-4H3/t16-/m0/s1 |
| InChIKey | RXICLABDVPIVFD-INIZCTEOSA-N |
| XLogP | 4.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |