C16H25NO2 — CID 117060748
N-benzyl-N-(1-methoxypropan-2-yl)-2,2-dimethylpropanamide (PubChem CID 117060748) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-benzyl-N-(1-methoxypropan-2-yl)-2,2-dimethylpropanamide.
| Compound Name | N-benzyl-N-(1-methoxypropan-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 117060748 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-benzyl-N-(1-methoxypropan-2-yl)-2,2-dimethylpropanamide |
| SMILES | COCC(C)N(Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H25NO2/c1-13(12-19-5)17(15(18)16(2,3)4)11-14-9-7-6-8-10-14/h6-10,13H,11-12H2,1-5H3 |
| InChIKey | HHXXHTZWQCJLRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |