C13H17BrFNO2 — CID 118957425
2-bromo-N-[(4-fluorophenyl)methyl]-N-[(2S)-1-methoxypropan-2-yl]acetamide (PubChem CID 118957425) has the molecular formula C13H17BrFNO2 and a molecular weight of 318.19 g/mol. Its IUPAC name is 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(2S)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957425 |
| Molecular Formula | C13H17BrFNO2 |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@H](C)N(Cc1ccc(F)cc1)C(=O)CBr |
| InChI | InChI=1S/C13H17BrFNO2/c1-10(9-18-2)16(13(17)7-14)8-11-3-5-12(15)6-4-11/h3-6,10H,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | GIIHGANFCJOPSG-JTQLQIEISA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|