C14H18BrNO4 — CID 53305745
methyl (2S)-2-[(2-bromoacetyl)-[(4-methoxyphenyl)methyl]amino]propanoate (PubChem CID 53305745) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is methyl (2S)-2-[(2-bromoacetyl)-[(4-methoxyphenyl)methyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[(2-bromoacetyl)-[(4-methoxyphenyl)methyl]amino]propanoate |
|---|---|
| PubChem CID | 53305745 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | methyl (2S)-2-[(2-bromoacetyl)-[(4-methoxyphenyl)methyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(Cc1ccc(OC)cc1)C(=O)CBr |
| InChI | InChI=1S/C14H18BrNO4/c1-10(14(18)20-3)16(13(17)8-15)9-11-4-6-12(19-2)7-5-11/h4-7,10H,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | BXMHTRMADLPCMQ-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|