C18H20BrNO3 — CID 10904936
2-bromo-N,N-bis[(4-methoxyphenyl)methyl]acetamide (PubChem CID 10904936) has the molecular formula C18H20BrNO3 and a molecular weight of 378.27 g/mol. Its IUPAC name is 2-bromo-N,N-bis[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-bromo-N,N-bis[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 10904936 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-bromo-N,N-bis[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)C(=O)CBr)cc1 |
| InChI | InChI=1S/C18H20BrNO3/c1-22-16-7-3-14(4-8-16)12-20(18(21)11-19)13-15-5-9-17(23-2)10-6-15/h3-10H,11-13H2,1-2H3 |
| InChIKey | IIRQTCGSQTVSSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|