C13H14Br3NO2 — CID 10527770
2,2,2-tribromo-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide (PubChem CID 10527770) has the molecular formula C13H14Br3NO2 and a molecular weight of 455.97 g/mol. Its IUPAC name is 2,2,2-tribromo-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide.
| Compound Name | 2,2,2-tribromo-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 10527770 |
| Molecular Formula | C13H14Br3NO2 |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 452.86 |
| IUPAC Name | 2,2,2-tribromo-N-[(4-methoxyphenyl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C13H14Br3NO2/c1-3-8-17(12(18)13(14,15)16)9-10-4-6-11(19-2)7-5-10/h3-7H,1,8-9H2,2H3 |
| InChIKey | OCFRZQVXOUEBHS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|