C21H27ClN2O2 — CID 119741680
3-amino-N-[(4-methoxyphenyl)methyl]-2-methyl-3-phenyl-N-prop-2-enylpropanamide;hydrochloride (PubChem CID 119741680) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 3-amino-N-[(4-methoxyphenyl)methyl]-2-methyl-3-phenyl-N-prop-2-enylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-[(4-methoxyphenyl)methyl]-2-methyl-3-phenyl-N-prop-2-enylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119741680 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-amino-N-[(4-methoxyphenyl)methyl]-2-methyl-3-phenyl-N-prop-2-enylpropanamide;hydrochloride |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)C(C)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C21H26N2O2.ClH/c1-4-14-23(15-17-10-12-19(25-3)13-11-17)21(24)16(2)20(22)18-8-6-5-7-9-18;/h4-13,16,20H,1,14-15,22H2,2-3H3;1H |
| InChIKey | LTNAMHXMYUWDMF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|