C27H29NO5 — CID 55917567
3,5-dimethoxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxy-N-prop-2-enylbenzamide (PubChem CID 55917567) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxy-N-prop-2-enylbenzamide.
| Compound Name | 3,5-dimethoxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 55917567 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3,5-dimethoxy-N-[(4-methoxyphenyl)methyl]-4-phenylmethoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)c1cc(OC)c(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H29NO5/c1-5-15-28(18-20-11-13-23(30-2)14-12-20)27(29)22-16-24(31-3)26(25(17-22)32-4)33-19-21-9-7-6-8-10-21/h5-14,16-17H,1,15,18-19H2,2-4H3 |
| InChIKey | SNUUUAOYHGFYJM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|