C23H23NO5 — CID 126484008
3-methoxy-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxybenzamide (PubChem CID 126484008) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-methoxy-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxybenzamide.
| Compound Name | 3-methoxy-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126484008 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 3-methoxy-5-[(4-methoxyphenyl)methoxy]-4-phenylmethoxybenzamide |
| SMILES | COc1ccc(COc2cc(C(N)=O)cc(OC)c2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-26-19-10-8-17(9-11-19)14-28-21-13-18(23(24)25)12-20(27-2)22(21)29-15-16-6-4-3-5-7-16/h3-13H,14-15H2,1-2H3,(H2,24,25) |
| InChIKey | QITFSLQBTWPVFM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |