C29H27NO5 — CID 139779676
3,5-dimethoxy-4-phenylmethoxy-N-(4-phenylmethoxyphenyl)benzamide (PubChem CID 139779676) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3,5-dimethoxy-4-phenylmethoxy-N-(4-phenylmethoxyphenyl)benzamide.
| Compound Name | 3,5-dimethoxy-4-phenylmethoxy-N-(4-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 139779676 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 3,5-dimethoxy-4-phenylmethoxy-N-(4-phenylmethoxyphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OCc3ccccc3)cc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H27NO5/c1-32-26-17-23(18-27(33-2)28(26)35-20-22-11-7-4-8-12-22)29(31)30-24-13-15-25(16-14-24)34-19-21-9-5-3-6-10-21/h3-18H,19-20H2,1-2H3,(H,30,31) |
| InChIKey | UTDYPJPQKPNKGI-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |