C22H20BrNO4 — CID 16567430
N-(4-bromophenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide (PubChem CID 16567430) has the molecular formula C22H20BrNO4 and a molecular weight of 442.31 g/mol. Its IUPAC name is N-(4-bromophenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(4-bromophenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 16567430 |
| Molecular Formula | C22H20BrNO4 |
| Molecular Weight | 442.31 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | N-(4-bromophenyl)-3,5-dimethoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Br)cc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H20BrNO4/c1-26-19-12-16(22(25)24-18-10-8-17(23)9-11-18)13-20(27-2)21(19)28-14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | PXOJGJXWFWILEL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |