C15H15BrO3 — CID 71601563
5-bromo-1,3-dimethoxy-2-phenylmethoxybenzene (PubChem CID 71601563) has the molecular formula C15H15BrO3 and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-bromo-1,3-dimethoxy-2-phenylmethoxybenzene.
| Compound Name | 5-bromo-1,3-dimethoxy-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 71601563 |
| Molecular Formula | C15H15BrO3 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-bromo-1,3-dimethoxy-2-phenylmethoxybenzene |
| SMILES | COc1cc(Br)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H15BrO3/c1-17-13-8-12(16)9-14(18-2)15(13)19-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | RPFUONAJZSPXGD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |