C17H17BrO4 — CID 164893025
2-(5-bromo-3-methoxy-2-phenylmethoxyphenyl)-1,3-dioxolane (PubChem CID 164893025) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-(5-bromo-3-methoxy-2-phenylmethoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-(5-bromo-3-methoxy-2-phenylmethoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 164893025 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-(5-bromo-3-methoxy-2-phenylmethoxyphenyl)-1,3-dioxolane |
| SMILES | COc1cc(Br)cc(C2OCCO2)c1OCc1ccccc1 |
| InChI | InChI=1S/C17H17BrO4/c1-19-15-10-13(18)9-14(17-20-7-8-21-17)16(15)22-11-12-5-3-2-4-6-12/h2-6,9-10,17H,7-8,11H2,1H3 |
| InChIKey | ZAFLEFBMJBSYKK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |