C21H27NO4 — CID 119124540
N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]oxan-3-amine (PubChem CID 119124540) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]oxan-3-amine.
| Compound Name | N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 119124540 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[(3,5-dimethoxy-4-phenylmethoxyphenyl)methyl]oxan-3-amine |
| SMILES | COc1cc(CNC2CCCOC2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H27NO4/c1-23-19-11-17(13-22-18-9-6-10-25-15-18)12-20(24-2)21(19)26-14-16-7-4-3-5-8-16/h3-5,7-8,11-12,18,22H,6,9-10,13-15H2,1-2H3 |
| InChIKey | FMSPYBCFDCRZPT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |