C22H29Cl2NO2 — CID 17158349
N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]cycloheptanamine;hydrochloride (PubChem CID 17158349) has the molecular formula C22H29Cl2NO2 and a molecular weight of 410.39 g/mol. Its IUPAC name is N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]cycloheptanamine;hydrochloride.
| Compound Name | N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]cycloheptanamine;hydrochloride |
|---|---|
| PubChem CID | 17158349 |
| Molecular Formula | C22H29Cl2NO2 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]cycloheptanamine;hydrochloride |
| SMILES | COc1cc(Cl)cc(CNC2CCCCCC2)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C22H28ClNO2.ClH/c1-25-21-14-19(23)13-18(15-24-20-11-7-2-3-8-12-20)22(21)26-16-17-9-5-4-6-10-17;/h4-6,9-10,13-14,20,24H,2-3,7-8,11-12,15-16H2,1H3;1H |
| InChIKey | BHGFSBWQAAMENI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |