C25H29Cl2NO2 — CID 17211455
N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-phenylbutan-2-amine;hydrochloride (PubChem CID 17211455) has the molecular formula C25H29Cl2NO2 and a molecular weight of 446.42 g/mol. Its IUPAC name is N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-phenylbutan-2-amine;hydrochloride.
| Compound Name | N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-phenylbutan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 17211455 |
| Molecular Formula | C25H29Cl2NO2 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methyl]-4-phenylbutan-2-amine;hydrochloride |
| SMILES | COc1cc(Cl)cc(CNC(C)CCc2ccccc2)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C25H28ClNO2.ClH/c1-19(13-14-20-9-5-3-6-10-20)27-17-22-15-23(26)16-24(28-2)25(22)29-18-21-11-7-4-8-12-21;/h3-12,15-16,19,27H,13-14,17-18H2,1-2H3;1H |
| InChIKey | DDQFDTUWVZHPRL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |