C25H28ClNO2 — CID 51988848
(2S)-N-[[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-phenylbutan-2-amine (PubChem CID 51988848) has the molecular formula C25H28ClNO2 and a molecular weight of 409.96 g/mol. Its IUPAC name is (2S)-N-[[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-phenylbutan-2-amine.
| Compound Name | (2S)-N-[[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 51988848 |
| Molecular Formula | C25H28ClNO2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S)-N-[[2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methyl]-4-phenylbutan-2-amine |
| SMILES | COc1cccc(CN[C@@H](C)CCc2ccccc2)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H28ClNO2/c1-19(14-15-20-8-4-3-5-9-20)27-17-22-11-7-13-24(28-2)25(22)29-18-21-10-6-12-23(26)16-21/h3-13,16,19,27H,14-15,17-18H2,1-2H3/t19-/m0/s1 |
| InChIKey | HFNPUPHJGVYOLS-IBGZPJMESA-N |
| XLogP | 6.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |