C25H27Cl2NO2 — CID 66529561
N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenylbutan-2-amine (PubChem CID 66529561) has the molecular formula C25H27Cl2NO2 and a molecular weight of 444.40 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenylbutan-2-amine.
| Compound Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 66529561 |
| Molecular Formula | C25H27Cl2NO2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-phenylbutan-2-amine |
| SMILES | COc1cc(CNC(C)CCc2ccccc2)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H27Cl2NO2/c1-18(8-9-19-6-4-3-5-7-19)28-16-21-14-24(29-2)25(15-23(21)27)30-17-20-10-12-22(26)13-11-20/h3-7,10-15,18,28H,8-9,16-17H2,1-2H3 |
| InChIKey | NBCXRRVKWBGBSX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |