C22H21Cl2NO2 — CID 66529232
N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylmethanamine (PubChem CID 66529232) has the molecular formula C22H21Cl2NO2 and a molecular weight of 402.32 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylmethanamine.
| Compound Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 66529232 |
| Molecular Formula | C22H21Cl2NO2 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[[2-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-1-phenylmethanamine |
| SMILES | COc1cc(CNCc2ccccc2)c(Cl)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21Cl2NO2/c1-26-21-11-18(14-25-13-16-5-3-2-4-6-16)20(24)12-22(21)27-15-17-7-9-19(23)10-8-17/h2-12,25H,13-15H2,1H3 |
| InChIKey | LEHAJVBQUBEVFL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |