C24H23Cl2NO3 — CID 58655143
3-(2-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-[(4-chlorophenyl)methyl]propanamide (PubChem CID 58655143) has the molecular formula C24H23Cl2NO3 and a molecular weight of 444.36 g/mol. Its IUPAC name is 3-(2-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-[(4-chlorophenyl)methyl]propanamide.
| Compound Name | 3-(2-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-[(4-chlorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 58655143 |
| Molecular Formula | C24H23Cl2NO3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-(2-chloro-5-methoxy-4-phenylmethoxyphenyl)-N-[(4-chlorophenyl)methyl]propanamide |
| SMILES | COc1cc(CCC(=O)NCc2ccc(Cl)cc2)c(Cl)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H23Cl2NO3/c1-29-22-13-19(9-12-24(28)27-15-17-7-10-20(25)11-8-17)21(26)14-23(22)30-16-18-5-3-2-4-6-18/h2-8,10-11,13-14H,9,12,15-16H2,1H3,(H,27,28) |
| InChIKey | RDJJLKATDKNLNB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |