C26H29NO5 — CID 55871682
N-[(4-phenylmethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 55871682) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[(4-phenylmethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-[(4-phenylmethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55871682 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[(4-phenylmethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCc2ccc(OCc3ccccc3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C26H29NO5/c1-29-23-15-11-21(25(30-2)26(23)31-3)12-16-24(28)27-17-19-9-13-22(14-10-19)32-18-20-7-5-4-6-8-20/h4-11,13-15H,12,16-18H2,1-3H3,(H,27,28) |
| InChIKey | GRDPUMOLPYFCDL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |