C14H19NO6 — CID 119171700
2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]acetic acid (PubChem CID 119171700) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]acetic acid.
| Compound Name | 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]acetic acid |
|---|---|
| PubChem CID | 119171700 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[3-(2,3,4-trimethoxyphenyl)propanoylamino]acetic acid |
| SMILES | COc1ccc(CCC(=O)NCC(=O)O)c(OC)c1OC |
| InChI | InChI=1S/C14H19NO6/c1-19-10-6-4-9(13(20-2)14(10)21-3)5-7-11(16)15-8-12(17)18/h4,6H,5,7-8H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | GXMZGPFSKWNORH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |