C16H26N2O4 — CID 119997065
N-(3-amino-2-methylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 119997065) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is N-(3-amino-2-methylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-(3-amino-2-methylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 119997065 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | N-(3-amino-2-methylpropyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCC(C)CN)c(OC)c1OC |
| InChI | InChI=1S/C16H26N2O4/c1-11(9-17)10-18-14(19)8-6-12-5-7-13(20-2)16(22-4)15(12)21-3/h5,7,11H,6,8-10,17H2,1-4H3,(H,18,19) |
| InChIKey | PXOLTJOTFGIYJE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |