C20H25NO5 — CID 55882512
N-(2-phenoxyethyl)-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 55882512) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-(2-phenoxyethyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55882512 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-(2-phenoxyethyl)-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CCC(=O)NCCOc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C20H25NO5/c1-23-17-11-9-15(19(24-2)20(17)25-3)10-12-18(22)21-13-14-26-16-7-5-4-6-8-16/h4-9,11H,10,12-14H2,1-3H3,(H,21,22) |
| InChIKey | YPHRMRSKYBKENX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|