C21H27NO6 — CID 55870487
N-[(3,5-dimethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide (PubChem CID 55870487) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 55870487 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-3-(2,3,4-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CNC(=O)CCc2ccc(OC)c(OC)c2OC)cc(OC)c1 |
| InChI | InChI=1S/C21H27NO6/c1-24-16-10-14(11-17(12-16)25-2)13-22-19(23)9-7-15-6-8-18(26-3)21(28-5)20(15)27-4/h6,8,10-12H,7,9,13H2,1-5H3,(H,22,23) |
| InChIKey | RLOYABNDDFWCIP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |