C21H27NO9 — CID 146115791
N-[(3,5-dimethoxyphenyl)methyl]-1-(2,3,4-trimethoxyphenyl)methanamine;oxalic acid (PubChem CID 146115791) has the molecular formula C21H27NO9 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[(3,5-dimethoxyphenyl)methyl]-1-(2,3,4-trimethoxyphenyl)methanamine;oxalic acid.
| Compound Name | N-[(3,5-dimethoxyphenyl)methyl]-1-(2,3,4-trimethoxyphenyl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 146115791 |
| Molecular Formula | C21H27NO9 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-[(3,5-dimethoxyphenyl)methyl]-1-(2,3,4-trimethoxyphenyl)methanamine;oxalic acid |
| SMILES | COc1cc(CNCc2ccc(OC)c(OC)c2OC)cc(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H25NO5.C2H2O4/c1-21-15-8-13(9-16(10-15)22-2)11-20-12-14-6-7-17(23-3)19(25-5)18(14)24-4;3-1(4)2(5)6/h6-10,20H,11-12H2,1-5H3;(H,3,4)(H,5,6) |
| InChIKey | ZWIHYXDLIULEKZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|