C19H23NO7 — CID 17052977
oxalic acid;1-phenyl-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine (PubChem CID 17052977) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is oxalic acid;1-phenyl-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine.
| Compound Name | oxalic acid;1-phenyl-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 17052977 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | oxalic acid;1-phenyl-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1ccc(CNCc2ccccc2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H21NO3.C2H2O4/c1-19-15-10-9-14(16(20-2)17(15)21-3)12-18-11-13-7-5-4-6-8-13;3-1(4)2(5)6/h4-10,18H,11-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | YUCPFNPNGQBHEP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|