C22H21NO7 — CID 17367399
1-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]methanamine;oxalic acid (PubChem CID 17367399) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]methanamine;oxalic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]methanamine;oxalic acid |
|---|---|
| PubChem CID | 17367399 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]methanamine;oxalic acid |
| SMILES | COc1ccc(CNCc2ccc3c(c2)OCO3)c2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H19NO3.C2H2O4/c1-22-18-9-7-15(16-4-2-3-5-17(16)18)12-21-11-14-6-8-19-20(10-14)24-13-23-19;3-1(4)2(5)6/h2-10,21H,11-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RGVDYNABFGNEME-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|