C18H18N2O5 — CID 108947229
N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-methoxyphenyl)propanediamide (PubChem CID 108947229) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-methoxyphenyl)propanediamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 108947229 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-(2-methoxyphenyl)propanediamide |
| SMILES | COc1ccccc1NC(=O)CC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O5/c1-23-14-5-3-2-4-13(14)20-18(22)9-17(21)19-10-12-6-7-15-16(8-12)25-11-24-15/h2-8H,9-11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | LWNRWFWYEDOSPV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|