C17H17NO4 — CID 87044794
2-(1,3-benzodioxol-5-yl)-N-(2-ethoxyphenyl)acetamide (PubChem CID 87044794) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 87044794 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H17NO4/c1-2-20-14-6-4-3-5-13(14)18-17(19)10-12-7-8-15-16(9-12)22-11-21-15/h3-9H,2,10-11H2,1H3,(H,18,19) |
| InChIKey | VSMLLCLZTNCZIV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |