C18H20N2O5 — CID 38210421
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea (PubChem CID 38210421) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 38210421 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccccc1OCCNC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O5/c1-22-14-4-2-3-5-15(14)23-9-8-19-18(21)20-11-13-6-7-16-17(10-13)25-12-24-16/h2-7,10H,8-9,11-12H2,1H3,(H2,19,20,21) |
| InChIKey | CVEUHKZRWQQRLZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|