C17H18N2O5 — CID 112971485
1-(1,3-benzodioxol-5-yl)-3-[2-(2-methoxyphenoxy)ethyl]urea (PubChem CID 112971485) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[2-(2-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112971485 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[2-(2-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccccc1OCCNC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H18N2O5/c1-21-13-4-2-3-5-14(13)22-9-8-18-17(20)19-12-6-7-15-16(10-12)24-11-23-15/h2-7,10H,8-9,11H2,1H3,(H2,18,19,20) |
| InChIKey | VTQNGAJEUFQOJD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|