C20H24N2O4 — CID 108881604
1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2,6-dimethylphenoxy)propyl]urea (PubChem CID 108881604) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2,6-dimethylphenoxy)propyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2,6-dimethylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 108881604 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[3-(2,6-dimethylphenoxy)propyl]urea |
| SMILES | Cc1cccc(C)c1OCCCNC(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24N2O4/c1-14-5-3-6-15(2)19(14)24-10-4-9-21-20(23)22-12-16-7-8-17-18(11-16)26-13-25-17/h3,5-8,11H,4,9-10,12-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | ROCFQDICKIZPAE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|