C19H21FN2O4 — CID 60601729
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(4-fluorophenoxy)propyl]urea (PubChem CID 60601729) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(4-fluorophenoxy)propyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(4-fluorophenoxy)propyl]urea |
|---|---|
| PubChem CID | 60601729 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[3-(4-fluorophenoxy)propyl]urea |
| SMILES | O=C(NCCCOc1ccc(F)cc1)NCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H21FN2O4/c20-15-3-5-16(6-4-15)24-9-1-8-21-19(23)22-13-14-2-7-17-18(12-14)26-11-10-25-17/h2-7,12H,1,8-11,13H2,(H2,21,22,23) |
| InChIKey | FOMUJKZJMPIOTG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|