C19H19ClFNO4 — CID 78867067
N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-(4-fluorophenoxy)butanamide (PubChem CID 78867067) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-(4-fluorophenoxy)butanamide.
| Compound Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 78867067 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]-4-(4-fluorophenoxy)butanamide |
| SMILES | O=C(CCCOc1ccc(F)cc1)NCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C19H19ClFNO4/c20-16-10-13(11-17-19(16)26-9-8-25-17)12-22-18(23)2-1-7-24-15-5-3-14(21)4-6-15/h3-6,10-11H,1-2,7-9,12H2,(H,22,23) |
| InChIKey | BARVEYJNODIDQQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|