C16H22ClNO4 — CID 60603260
N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-methoxypentanamide (PubChem CID 60603260) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-methoxypentanamide.
| Compound Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-methoxypentanamide |
|---|---|
| PubChem CID | 60603260 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-5-methoxypentanamide |
| SMILES | COCCCCC(=O)NCc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C16H22ClNO4/c1-20-6-3-2-5-15(19)18-11-12-9-13(17)16-14(10-12)21-7-4-8-22-16/h9-10H,2-8,11H2,1H3,(H,18,19) |
| InChIKey | LNXFFBQLXJKEAZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|