C18H18F2N2O5 — CID 55741471
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea (PubChem CID 55741471) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55741471 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[[4-(difluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCCOc1ccc2c(c1)OCO2)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H18F2N2O5/c19-17(20)27-13-3-1-12(2-4-13)10-22-18(23)21-7-8-24-14-5-6-15-16(9-14)26-11-25-15/h1-6,9,17H,7-8,10-11H2,(H2,21,22,23) |
| InChIKey | AMRBRCCAJVYQPC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|